Compound Q&A

How is tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) typically synthesized?

Answer

tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is commonly synthesized through a multi-step process involving the protection of a hydroxyl group followed by a benzyl substitution reaction. The synthesis typically uses tert-butyldimethylsilyl chloride as a protecting agent and catalytic amounts of a Lewis acid such as BF3•OEt2 to facilitate the benzylation step. The yield and selectivity can be optimized through careful choice of reaction conditions.

About

English Name tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate
Molecular Formula C13H19NO4
Molecular Weight 253.3 g/mol
SMILES CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)O)OC
InChIKey SAFGFWHMYJRFPH-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3) is a white crystalline solid with a...

Compound Q&A

What industries use tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

Tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate is used in various industries, particularly in pharmac...

Compound Q&A

What precautions should be taken when handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3)?

When handling tert-butyl 4-hydroxy-3-MethoxybenzylcarbaMate (CAS: 130972-89-3), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...