Compound Q&A

What precautions should be taken when handling 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

Answer

4-(6-Isocyanato-2-pyridinyl)morpholine
When handling 4-(6-Isocyanato-2-pyridinyl)morpholine, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to the air. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. In case of skin contact, wash the affected area with copious amounts of water. For ingestion, seek medical attention immediately. Safety data sheets (SDS) should always be referenced for specific handling instructions and emergency procedures.

About

English Name 4-(6-Isocyanato-2-pyridinyl)morpholine
Molecular Formula C10H11N3O2
Molecular Weight 205.22 g/mol
SMILES C1COCCN1C2=CC=CC(=N2)N=C=O
InChIKey RYYZXDNHAQDJTI-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

4-(6-Isocyanato-2-pyridinyl)morpholine is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7) typically synthesized?

4-(6-Isocyanato-2-pyridinyl)morpholine is typically synthesized via the reaction of morpholine with ...

Compound Q&A

What industries use 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

4-(6-Isocyanato-2-pyridinyl)morpholine is primarily utilized in the pharmaceutical and chemical indu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...