Compound Q&A

What are the physical and chemical properties of 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

Answer

4-(6-Isocyanato-2-pyridinyl)morpholine
4-(6-Isocyanato-2-pyridinyl)morpholine is a crystalline solid with a molecular weight of approximately 202.18 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Reactively, it is highly reactive due to the presence of the isocyanate group, which can participate in various types of chemical reactions. This compound is stable under normal conditions but requires careful handling to avoid decomposition or reaction with air and moisture.

About

English Name 4-(6-Isocyanato-2-pyridinyl)morpholine
Molecular Formula C10H11N3O2
Molecular Weight 205.22 g/mol
SMILES C1COCCN1C2=CC=CC(=N2)N=C=O
InChIKey RYYZXDNHAQDJTI-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7) typically synthesized?

4-(6-Isocyanato-2-pyridinyl)morpholine is typically synthesized via the reaction of morpholine with ...

Compound Q&A

What industries use 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

4-(6-Isocyanato-2-pyridinyl)morpholine is primarily utilized in the pharmaceutical and chemical indu...

Compound Q&A

What precautions should be taken when handling 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

When handling 4-(6-Isocyanato-2-pyridinyl)morpholine, it is essential to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...