AD

4-(6-Isocyanato-2-pyridinyl)morpholine(CAS: 884507-15-7)

4-(6-Isocyanato-2-pyridinyl)morpholine
CAS Number

Related Products

Other Suppliers for 4-(6-Isocyanato-2-pyridinyl)morpholine

Basic Information

Molecular Formula
C10H11N3O2
Molecular Weight
205.22 g/mol

Physical Properties

Boiling Point
127 °C

Chemical Identifiers

SMILES
C1COCCN1C2=CC=CC(=N2)N=C=O
InChIKey
RYYZXDNHAQDJTI-UHFFFAOYSA-N

Database References

MDL Number
MFCD08435861

FAQ

4-(6-Isocyanato-2-pyridinyl)morpholine is a crystalline solid with a molecular weight of approximately 202.18 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Reactively, it is highly reactive due to the presence of the isocyanate group, which can participate in various types of chemical reactions. This compound is stable under normal conditions but requires careful handling to avoid decomposition or reaction with air and moisture.
4-(6-Isocyanato-2-pyridinyl)morpholine is typically synthesized via the reaction of morpholine with 6-aminopyridine in the presence of a suitable amine scavenger. The process involves the formation of an isocyanate intermediate, followed by its reaction with morpholine. The yield is generally high, and the reaction is conducted under basic conditions to ensure good selectivity and yield. Common solvents include DMF or DMSO, and the reaction is monitored using thin-layer chromatography (TLC) to ensure completion.
4-(6-Isocyanato-2-pyridinyl)morpholine is primarily utilized in the pharmaceutical and chemical industries due to its reactivity and unique chemical structure. It is used as an intermediate in the synthesis of various pharmaceutical compounds, especially those requiring specific functional groups. Additionally, it can be used in the development of certain polymers and materials, where its unique properties can be beneficial.
When handling 4-(6-Isocyanato-2-pyridinyl)morpholine, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be handled in a fume hood to minimize exposure to the air. Spills should be cleaned up immediately using appropriate absorbents, and the area should be well-ventilated. In case of skin contact, wash the affected area with copious amounts of water. For ingestion, seek medical attention immediately. Safety data sheets (SDS) should always be referenced for specific handling instructions and emergency procedures.

Safety Notice

Please verify product specifications and safety data before use. Contact the supplier for detailed safety information.

Always follow proper handling procedures

Contact Information

Contact Person

Aladdin

Email

market@aladdin-e.com