Compound Q&A

How is 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7) typically synthesized?

Answer

4-(6-Isocyanato-2-pyridinyl)morpholine
4-(6-Isocyanato-2-pyridinyl)morpholine is typically synthesized via the reaction of morpholine with 6-aminopyridine in the presence of a suitable amine scavenger. The process involves the formation of an isocyanate intermediate, followed by its reaction with morpholine. The yield is generally high, and the reaction is conducted under basic conditions to ensure good selectivity and yield. Common solvents include DMF or DMSO, and the reaction is monitored using thin-layer chromatography (TLC) to ensure completion.

About

English Name 4-(6-Isocyanato-2-pyridinyl)morpholine
Molecular Formula C10H11N3O2
Molecular Weight 205.22 g/mol
SMILES C1COCCN1C2=CC=CC(=N2)N=C=O
InChIKey RYYZXDNHAQDJTI-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

4-(6-Isocyanato-2-pyridinyl)morpholine is a crystalline solid with a molecular weight of approximate...

Compound Q&A

What industries use 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

4-(6-Isocyanato-2-pyridinyl)morpholine is primarily utilized in the pharmaceutical and chemical indu...

Compound Q&A

What precautions should be taken when handling 4-(6-Isocyanato-2-pyridinyl)morpholine (CAS: 884507-15-7)?

When handling 4-(6-Isocyanato-2-pyridinyl)morpholine, it is essential to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...