Compound Q&A

What precautions should be taken when handling 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

Answer

2,3-Dichloroquinoxaline-5-carboxylic acid
When handling 2,3-Dichloroquinoxaline-5-carboxylic acid, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation of the substance. Spills should be cleaned up immediately using appropriate absorbent materials. Always refer to the safety data sheet (SDS) for detailed guidance on safe handling and disposal procedures.

About

English Name 2,3-Dichloroquinoxaline-5-carboxylic acid
Molecular Formula C9H4Cl2N2O2
Molecular Weight 243.05 g/mol
SMILES C1=CC(=C2C(=C1)N=C(C(=N2)Cl)Cl)C(=O)O
InChIKey NMYQKGFEKBEDKB-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1) typically synthesized?

2,3-Dichloroquinoxaline-5-carboxylic acid is typically synthesized through the reaction of 2,3-dichl...

Compound Q&A

What industries use 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid finds applications in the pharmaceutical industry due to i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...