Compound Q&A

What are the physical and chemical properties of 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

Answer

2,3-Dichloroquinoxaline-5-carboxylic acid
2,3-Dichloroquinoxaline-5-carboxylic acid is a crystalline solid with a molecular weight of approximately 229.03 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and acetone. The compound shows limited reactivity under normal conditions, but it can undergo hydrolysis in basic media. It has a melting point around 210-212°C. This acid is typically stable under normal storage conditions but should be handled with care due to its reactivity.

About

English Name 2,3-Dichloroquinoxaline-5-carboxylic acid
Molecular Formula C9H4Cl2N2O2
Molecular Weight 243.05 g/mol
SMILES C1=CC(=C2C(=C1)N=C(C(=N2)Cl)Cl)C(=O)O
InChIKey NMYQKGFEKBEDKB-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1) typically synthesized?

2,3-Dichloroquinoxaline-5-carboxylic acid is typically synthesized through the reaction of 2,3-dichl...

Compound Q&A

What industries use 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid finds applications in the pharmaceutical industry due to i...

Compound Q&A

What precautions should be taken when handling 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

When handling 2,3-Dichloroquinoxaline-5-carboxylic acid, it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...