Compound Q&A

What industries use 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

Answer

2,3-Dichloroquinoxaline-5-carboxylic acid
2,3-Dichloroquinoxaline-5-carboxylic acid finds applications in the pharmaceutical industry due to its potential as a starting material for the synthesis of drug candidates. It also has uses in the polymer industry as a monomer for the production of certain polymers. Additionally, this compound is used in the field of sensors for its unique chemical properties and in the semiconductor industry for its electronic characteristics.

About

English Name 2,3-Dichloroquinoxaline-5-carboxylic acid
Molecular Formula C9H4Cl2N2O2
Molecular Weight 243.05 g/mol
SMILES C1=CC(=C2C(=C1)N=C(C(=N2)Cl)Cl)C(=O)O
InChIKey NMYQKGFEKBEDKB-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

How is 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1) typically synthesized?

2,3-Dichloroquinoxaline-5-carboxylic acid is typically synthesized through the reaction of 2,3-dichl...

Compound Q&A

What precautions should be taken when handling 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

When handling 2,3-Dichloroquinoxaline-5-carboxylic acid, it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...