Compound Q&A

How is 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1) typically synthesized?

Answer

2,3-Dichloroquinoxaline-5-carboxylic acid
2,3-Dichloroquinoxaline-5-carboxylic acid is typically synthesized through the reaction of 2,3-dichloroquinoxaline with carboxylation reagents. Common methods involve treating the quinoxaline with carbon dioxide in the presence of a base such as sodium carbonate. The reaction is selective, yielding the acid with good yield. This process usually occurs under mild conditions, making it a feasible method for industrial synthesis.

About

English Name 2,3-Dichloroquinoxaline-5-carboxylic acid
Molecular Formula C9H4Cl2N2O2
Molecular Weight 243.05 g/mol
SMILES C1=CC(=C2C(=C1)N=C(C(=N2)Cl)Cl)C(=O)O
InChIKey NMYQKGFEKBEDKB-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid is a crystalline solid with a molecular weight of approxim...

Compound Q&A

What industries use 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

2,3-Dichloroquinoxaline-5-carboxylic acid finds applications in the pharmaceutical industry due to i...

Compound Q&A

What precautions should be taken when handling 2,3-Dichloroquinoxaline-5-carboxylic acid (CAS: 933726-33-1)?

When handling 2,3-Dichloroquinoxaline-5-carboxylic acid, it is important to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...