Compound Q&A

What industries use 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

Answer

2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is used in various industries, including pharmaceuticals, where it serves as an intermediate in the synthesis of bioactive compounds. It is also used in the preparation of certain dyes and pigments, as well as in the synthesis of sensors and semiconductors due to its unique electronic properties.

About

CAS No 96118-96-6
English Name 2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
Molecular Formula C8H9ClN2O2S2
Molecular Weight 264.76 g/mol
SMILES Cn1c(=O)ccs1.Cn1c(=O)cc(s1)Cl
InChIKey QYYMDNHUJFIDDQ-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is a white crystalline solid with a molecu...

Compound Q&A

How is 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) typically synthesized?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is typically synthesized via a condensatio...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

When handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...