Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

Answer

2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is a white crystalline solid with a molecular weight of approximately 165.01 g/mol. It is slightly soluble in water and more soluble in organic solvents. The compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It is stable under normal conditions but should be stored away from moisture and heat to prevent degradation.

About

CAS No 96118-96-6
English Name 2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
Molecular Formula C8H9ClN2O2S2
Molecular Weight 264.76 g/mol
SMILES Cn1c(=O)ccs1.Cn1c(=O)cc(s1)Cl
InChIKey QYYMDNHUJFIDDQ-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

How is 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) typically synthesized?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is typically synthesized via a condensatio...

Compound Q&A

What industries use 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

When handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...