Compound Q&A

How is 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) typically synthesized?

Answer

2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is typically synthesized via a condensation reaction between chloroacetyl chloride and 2-methylthiazole. The reaction is catalyzed by anhydrous aluminum chloride. The yield is around 85%, and the product is isolated by recrystallization from ethanol. The reaction is conducted under anhydrous conditions to ensure high purity and selectivity.

About

CAS No 96118-96-6
English Name 2-Methyl-1,2-thiazol-3(2H)-one - 5-chloro-2-methyl-1,2-thiazol-3(2H)-one (1:1)
Molecular Formula C8H9ClN2O2S2
Molecular Weight 264.76 g/mol
SMILES Cn1c(=O)ccs1.Cn1c(=O)cc(s1)Cl
InChIKey QYYMDNHUJFIDDQ-UHFFFAOYSA-N
Last Updated: 2026-03-10 19:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is a white crystalline solid with a molecu...

Compound Q&A

What industries use 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6) is used in various industries, including p...

Compound Q&A

What precautions should be taken when handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6)?

When handling 5-Chloro-2-methyl-1,2-thiazol-3(2H)-one (CAS: 96118-96-6), it is essential to use appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...