Compound Q&A

What precautions should be taken when handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

Answer

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
When handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. It should be stored in a cool, dry place away from heat sources and oxidizing agents. In case of a spill, clean it up using appropriate absorbent materials and follow the Safety Data Sheet (SDS) for further instructions. Always ensure proper ventilation and use a fume hood when necessary.

About

English Name [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
Molecular Formula C13H19NO2
Molecular Weight 221.3 g/mol
SMILES C[C@@H]1CN(C[C@@H](O1)CO)Cc2ccccc2
InChIKey VGPHTTKTZQGSHW-DGCLKSJQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

The compound [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is a white crysta...

Compound Q&A

How is [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) typically synthesized?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) can be synthesized through a m...

Compound Q&A

What industries use [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is primarily used in the pharm...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...