Compound Q&A

How is [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) typically synthesized?

Answer

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) can be synthesized through a multi-step process involving the preparation of 2-benzyl-6-methylmorpholine, followed by reaction with benzyl alcohol. This involves a Sonogashira coupling and a Grignard reaction. The final product is obtained with good yield and selectivity, making it a useful intermediate in organic synthesis.

About

English Name [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
Molecular Formula C13H19NO2
Molecular Weight 221.3 g/mol
SMILES C[C@@H]1CN(C[C@@H](O1)CO)Cc2ccccc2
InChIKey VGPHTTKTZQGSHW-DGCLKSJQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

The compound [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is a white crysta...

Compound Q&A

What industries use [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

When handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...