Compound Q&A

What industries use [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

Answer

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of drugs. It is also utilized in the production of polymers and in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
Molecular Formula C13H19NO2
Molecular Weight 221.3 g/mol
SMILES C[C@@H]1CN(C[C@@H](O1)CO)Cc2ccccc2
InChIKey VGPHTTKTZQGSHW-DGCLKSJQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

The compound [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is a white crysta...

Compound Q&A

How is [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) typically synthesized?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) can be synthesized through a m...

Compound Q&A

What precautions should be taken when handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

When handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4), it is essential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...