Compound Q&A

What are the physical and chemical properties of [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

Answer

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
The compound [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is a white crystalline solid with a molecular weight of approximately 275.31 g/mol. It has a moderate solubility in common organic solvents such as methanol and ethanol but is poorly soluble in water. Chemically, it exhibits good reactivity toward nucleophiles and can undergo substitution reactions. It is stable under normal conditions but should be stored in a cool, dry place away from strong oxidizing agents.

About

English Name [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol
Molecular Formula C13H19NO2
Molecular Weight 221.3 g/mol
SMILES C[C@@H]1CN(C[C@@H](O1)CO)Cc2ccccc2
InChIKey VGPHTTKTZQGSHW-DGCLKSJQSA-N
Last Updated: 2026-03-10 14:55

Related Q&A

Compound Q&A

How is [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) typically synthesized?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) can be synthesized through a m...

Compound Q&A

What industries use [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

[(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4) is primarily used in the pharm...

Compound Q&A

What precautions should be taken when handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4)?

When handling [(2R,6R)-4-Benzyl-6-methyl-2-morpholinyl]methanol (CAS: 1821773-67-4), it is essential...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...