Compound Q&A

What precautions should be taken when handling 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

Answer

8-Methoxy-5-quinolinesulfonyl chloride
When handling 8-Methoxy-5-quinolinesulfonyl chloride, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation. Spills should be carefully cleaned up using absorbent materials, and the area should be washed with water. Always consult the Safety Data Sheet (SDS) for detailed handling and storage instructions.

About

CAS No 90429-62-2
English Name 8-Methoxy-5-quinolinesulfonyl chloride
Molecular Formula C10H8ClNO3S
Molecular Weight 257.7 g/mol
SMILES COC1=C2C(=C(C=C1)S(=O)(=O)Cl)C=CC=N2
InChIKey CDUVKSFUNYBONL-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

8-Methoxy-5-quinolinesulfonyl chloride is a white crystalline solid with a molecular weight of 274.0...

Compound Q&A

How is 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2) typically synthesized?

8-Methoxy-5-quinolinesulfonyl chloride is synthesized through the condensation of 5-quinolinesulfony...

Compound Q&A

What industries use 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

8-Methoxy-5-quinolinesulfonyl chloride is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...