Compound Q&A

How is 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2) typically synthesized?

Answer

8-Methoxy-5-quinolinesulfonyl chloride
8-Methoxy-5-quinolinesulfonyl chloride is synthesized through the condensation of 5-quinolinesulfonyl chloride with methanol under basic conditions. The reaction involves the use of a catalyst such as potassium carbonate, followed by purification of the product through recrystallization. The yield is generally good, and the method is selective and scalable.

About

CAS No 90429-62-2
English Name 8-Methoxy-5-quinolinesulfonyl chloride
Molecular Formula C10H8ClNO3S
Molecular Weight 257.7 g/mol
SMILES COC1=C2C(=C(C=C1)S(=O)(=O)Cl)C=CC=N2
InChIKey CDUVKSFUNYBONL-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

8-Methoxy-5-quinolinesulfonyl chloride is a white crystalline solid with a molecular weight of 274.0...

Compound Q&A

What industries use 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

8-Methoxy-5-quinolinesulfonyl chloride is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

When handling 8-Methoxy-5-quinolinesulfonyl chloride, it is essential to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...