Compound Q&A

What are the physical and chemical properties of 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

Answer

8-Methoxy-5-quinolinesulfonyl chloride
8-Methoxy-5-quinolinesulfonyl chloride is a white crystalline solid with a molecular weight of 274.07 g/mol. It has a high solubility in organic solvents like dichloromethane and methylene chloride. Chemically, it is reactive and forms stable derivatives with nucleophiles. It is also susceptible to hydrolysis and requires storage under dry conditions.

About

CAS No 90429-62-2
English Name 8-Methoxy-5-quinolinesulfonyl chloride
Molecular Formula C10H8ClNO3S
Molecular Weight 257.7 g/mol
SMILES COC1=C2C(=C(C=C1)S(=O)(=O)Cl)C=CC=N2
InChIKey CDUVKSFUNYBONL-UHFFFAOYSA-N
Last Updated: 2026-03-07 15:41

Related Q&A

Compound Q&A

How is 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2) typically synthesized?

8-Methoxy-5-quinolinesulfonyl chloride is synthesized through the condensation of 5-quinolinesulfony...

Compound Q&A

What industries use 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

8-Methoxy-5-quinolinesulfonyl chloride is primarily used in the pharmaceutical industry for the synt...

Compound Q&A

What precautions should be taken when handling 8-Methoxy-5-quinolinesulfonyl chloride (CAS: 90429-62-2)?

When handling 8-Methoxy-5-quinolinesulfonyl chloride, it is essential to use appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...