Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

Answer

2-Fluoro-5-(trifluoromethyl)benzyl chloride
When handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride, it is crucial to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Work should be carried out in a well-ventilated fume hood to minimize exposure. Spills should be managed carefully, with the area being neutralized and cleaned up according to the Material Safety Data Sheet (MSDS/SDS) guidelines. Proper disposal should follow local regulations to ensure environmental safety.

About

English Name 2-Fluoro-5-(trifluoromethyl)benzyl chloride
Molecular Formula C8H5ClF4
Molecular Weight 212.57 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)CCl)F
InChIKey OZGWDDBROIXNRQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is a colorless to pale yellow liquid at room temperature...

Compound Q&A

How is 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8) typically synthesized?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is typically synthesized via the reaction of 2-fluoro-5-...

Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride finds applications in the pharmaceutical industry for th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...