Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

Answer

2-Fluoro-5-(trifluoromethyl)benzyl chloride
2-Fluoro-5-(trifluoromethyl)benzyl chloride is a colorless to pale yellow liquid at room temperature. Its molecular weight is approximately 274.03 g/mol. It has a high boiling point of around 115°C and is slightly soluble in water. This compound is highly reactive due to the presence of the fluorine and trifluoromethyl substituents, making it prone to nucleophilic substitution reactions.

About

English Name 2-Fluoro-5-(trifluoromethyl)benzyl chloride
Molecular Formula C8H5ClF4
Molecular Weight 212.57 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)CCl)F
InChIKey OZGWDDBROIXNRQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

How is 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8) typically synthesized?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is typically synthesized via the reaction of 2-fluoro-5-...

Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

When handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...