Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

Answer

2-Fluoro-5-(trifluoromethyl)benzyl chloride
2-Fluoro-5-(trifluoromethyl)benzyl chloride finds applications in the pharmaceutical industry for the synthesis of complex organic compounds, particularly in the development of drugs targeting specific molecular structures. It is also used in the polymer industry for the modification of polymers and in the semiconductor industry for the production of electronic materials. Its unique chemical properties make it useful in various analytical and sensor applications.

About

English Name 2-Fluoro-5-(trifluoromethyl)benzyl chloride
Molecular Formula C8H5ClF4
Molecular Weight 212.57 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)CCl)F
InChIKey OZGWDDBROIXNRQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is a colorless to pale yellow liquid at room temperature...

Compound Q&A

How is 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8) typically synthesized?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is typically synthesized via the reaction of 2-fluoro-5-...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

When handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...