Compound Q&A

How is 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8) typically synthesized?

Answer

2-Fluoro-5-(trifluoromethyl)benzyl chloride
2-Fluoro-5-(trifluoromethyl)benzyl chloride is typically synthesized via the reaction of 2-fluoro-5-(trifluoromethyl)benzyl alcohol with thionyl chloride. This process involves the conversion of the alcohol to its chloride derivative under mild conditions, with high selectivity and yield. The reaction is usually conducted in a non-polar solvent to minimize side reactions.

About

English Name 2-Fluoro-5-(trifluoromethyl)benzyl chloride
Molecular Formula C8H5ClF4
Molecular Weight 212.57 g/mol
SMILES C1=CC(=C(C=C1C(F)(F)F)CCl)F
InChIKey OZGWDDBROIXNRQ-UHFFFAOYSA-N
Last Updated: 2026-03-05 12:33

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride is a colorless to pale yellow liquid at room temperature...

Compound Q&A

What industries use 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

2-Fluoro-5-(trifluoromethyl)benzyl chloride finds applications in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride (CAS: 883543-26-8)?

When handling 2-Fluoro-5-(trifluoromethyl)benzyl chloride, it is crucial to use appropriate personal...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...