Compound Q&A

What industries use 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

Answer

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of other compounds. It is also utilized in the production of dyes and pigments, and in the development of sensors and semiconductors. Its applications in polymers and materials science are also expanding due to its unique functional groups.

About

CAS No 6334-97-0
English Name 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
Molecular Formula C12H11NO5S
Molecular Weight 281.29 g/mol
SMILES CC(=O)NC1=CC2=CC(=CC(=C2C=C1)O)S(=O)(=O)O
InChIKey KKAMNIDZQVXDJV-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) is a crystalline solid with a mole...

Compound Q&A

How is 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) typically synthesized?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is typically synthesized by the sulfonation of 7-ac...

Compound Q&A

What precautions should be taken when handling 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

Proper handling of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) requires the us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...