Compound Q&A

How is 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) typically synthesized?

Answer

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is typically synthesized by the sulfonation of 7-acetamido-4-hydroxy-2-naphthoic acid using fuming sulfuric acid in the presence of a catalyst such as aluminum sulfate. The reaction involves the introduction of a sulfonic acid group on the naphthalene ring, followed by the removal of the hydroxyl group to form the sulfonic acid salt. High yield and good selectivity are achieved under controlled conditions.

About

CAS No 6334-97-0
English Name 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
Molecular Formula C12H11NO5S
Molecular Weight 281.29 g/mol
SMILES CC(=O)NC1=CC2=CC(=CC(=C2C=C1)O)S(=O)(=O)O
InChIKey KKAMNIDZQVXDJV-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) is a crystalline solid with a mole...

Compound Q&A

What industries use 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is used in various industries, including pharmaceut...

Compound Q&A

What precautions should be taken when handling 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

Proper handling of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) requires the us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...