Compound Q&A

What are the physical and chemical properties of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

Answer

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) is a crystalline solid with a molecular weight of approximately 308.27 g/mol. It is moderately soluble in water and ethanol. The compound is known for its reactivity towards nucleophiles and its ability to form complexes with various metal ions. It has an acidic nature due to the sulfonic acid group and a hydroxyl group which can participate in hydrogen bonding.

About

CAS No 6334-97-0
English Name 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid
Molecular Formula C12H11NO5S
Molecular Weight 281.29 g/mol
SMILES CC(=O)NC1=CC2=CC(=CC(=C2C=C1)O)S(=O)(=O)O
InChIKey KKAMNIDZQVXDJV-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

How is 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) typically synthesized?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is typically synthesized by the sulfonation of 7-ac...

Compound Q&A

What industries use 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid is used in various industries, including pharmaceut...

Compound Q&A

What precautions should be taken when handling 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0)?

Proper handling of 7-Acetamido-4-hydroxy-2-naphthalenesulfonic acid (CAS: 6334-97-0) requires the us...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...