Compound Q&A

What precautions should be taken when handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

Answer

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
When handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure to vapors. Spills should be immediately neutralized with an appropriate base and cleaned up with absorbent material. Always consult the safety data sheet (SDS) for detailed information on handling and disposal.

About

English Name 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC(=CC=C2)F)C(=O)O
InChIKey VWUDHUJSDJLKJL-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is a white to light yellow crystalline solid with a m...

Compound Q&A

How is 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8) typically synthesized?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized through a multistep reaction...

Compound Q&A

What industries use 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...