Compound Q&A

How is 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8) typically synthesized?

Answer

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized through a multistep reaction starting with 3-fluorobenzyl chloride and piperidine. The key steps involve the formation of an acyl chloride followed by condensation with piperidine, with careful control of reaction conditions to ensure high yield and selectivity. Commonly used catalysts include phosphorous oxychloride or thionyl chloride.

About

English Name 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC(=CC=C2)F)C(=O)O
InChIKey VWUDHUJSDJLKJL-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is a white to light yellow crystalline solid with a m...

Compound Q&A

What industries use 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

When handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...