Compound Q&A

What industries use 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

Answer

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for the synthesis of drug candidates, particularly in the development of analgesics and anti-inflammatory agents. It is also explored in the polymer industry for its potential use in the formulation of biomedical polymers and in the electronics sector for its suitability in semiconductor applications.

About

English Name 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC(=CC=C2)F)C(=O)O
InChIKey VWUDHUJSDJLKJL-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is a white to light yellow crystalline solid with a m...

Compound Q&A

How is 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8) typically synthesized?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized through a multistep reaction...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

When handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...