Compound Q&A

What are the physical and chemical properties of 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

Answer

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is a white to light yellow crystalline solid with a molecular weight of approximately 284.23 g/mol. It is slightly soluble in water but soluble in common organic solvents such as ethanol and acetone. The compound has a moderate reactivity, particularly with nucleophiles, and is stable under normal storage conditions but hydrolyzes slowly in basic media.

About

English Name 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid
Molecular Formula C13H16FNO2
Molecular Weight 237.27 g/mol
SMILES C1CC(CN(C1)CC2=CC(=CC=C2)F)C(=O)O
InChIKey VWUDHUJSDJLKJL-UHFFFAOYSA-N
Last Updated: 2026-03-04 16:30

Related Q&A

Compound Q&A

How is 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8) typically synthesized?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is typically synthesized through a multistep reaction...

Compound Q&A

What industries use 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid is primarily used in the pharmaceutical industry for ...

Compound Q&A

What precautions should be taken when handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid (CAS: 896046-85-8)?

When handling 1-(3-Fluorobenzyl)-3-piperidinecarboxylic acid, it is crucial to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...