Compound Q&A

What precautions should be taken when handling 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

Answer

2-Fluoro-pyridine-3-sulfonyl chloride
When handling 2-Fluoro-pyridine-3-sulfonyl chloride, it is important to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a laboratory coat. The compound should be handled in a well-ventilated area or within a fume hood due to its volatility and reactivity. Spills should be handled immediately using appropriate cleanup procedures as outlined in the safety data sheet (SDS). Good laboratory practice and adherence to safety guidelines are essential to ensure safe handling and use.

About

English Name 2-Fluoro-pyridine-3-sulfonyl chloride
Molecular Formula C5H3ClFNO2S
Molecular Weight 195.60199999999998 g/mol
SMILES C1=CC(=C(N=C1)F)S(=O)(=O)Cl
InChIKey MSOAVTSXBMHOEM-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

2-Fluoro-pyridine-3-sulfonyl chloride is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0) typically synthesized?

2-Fluoro-pyridine-3-sulfonyl chloride can be synthesized through the chlorosulfonation of 2-fluoro-p...

Compound Q&A

What industries use 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

2-Fluoro-pyridine-3-sulfonyl chloride finds applications in pharmaceuticals, where it is used as an ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...