Compound Q&A

What are the physical and chemical properties of 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

Answer

2-Fluoro-pyridine-3-sulfonyl chloride
2-Fluoro-pyridine-3-sulfonyl chloride is a white crystalline solid with a molecular weight of approximately 219.66 g/mol. It is slightly soluble in water but more soluble in organic solvents like dimethylformamide (DMF) and acetonitrile. This compound is known for its high reactivity, particularly in nucleophilic substitution reactions. It is a potent electrophile and can undergo various chemical transformations under different conditions.

About

English Name 2-Fluoro-pyridine-3-sulfonyl chloride
Molecular Formula C5H3ClFNO2S
Molecular Weight 195.60199999999998 g/mol
SMILES C1=CC(=C(N=C1)F)S(=O)(=O)Cl
InChIKey MSOAVTSXBMHOEM-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

How is 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0) typically synthesized?

2-Fluoro-pyridine-3-sulfonyl chloride can be synthesized through the chlorosulfonation of 2-fluoro-p...

Compound Q&A

What industries use 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

2-Fluoro-pyridine-3-sulfonyl chloride finds applications in pharmaceuticals, where it is used as an ...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

When handling 2-Fluoro-pyridine-3-sulfonyl chloride, it is important to use appropriate personal pro...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...