Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Answer

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment of hepatitis B virus (HBV) infection. It is a nucleoside reverse transcriptase inhibitor (NRTI) that works by inhibiting the activity of the HBV polymerase enzyme, thereby preventing the virus from replicating.

About

CAS No 254435-95-5

English Name Alisporivir

Molecular Formula C63H113N11O12

Molecular Weight 1216.6619999999982 g/mol

SMILES CCC1C(=O)N(C(C(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1)C(C(C)CC=CC)O)C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)C(C)C)CC)C)C

InChIKey OLROWHGDTNFZBH-XEMWPYQTSA-N

Last Updated: 2026-01-09 10:47

Related Q&A

Compound Q&A

What are the main uses of Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is primarily used for the treatment of chronic hepatitis B virus (HBV...

Compound Q&A

Is Alisporivir (CAS: 254435-95-5) safe?

Alisporivir (CAS: 254435-95-5) is generally considered safe when used under the guidance of a health...

Compound Q&A

How should Alisporivir (CAS: 254435-95-5) be stored?

Alisporivir (CAS: 254435-95-5) should be stored at room temperature (15-30°C or 59-86°F), away from ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...

Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...

Compound Q&A