Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

Answer

[1,2,4]triazolo[3,4-a]phthalazine
[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with a molecular weight of approximately 265.25 g/mol. It has limited water solubility but is soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO). This compound shows moderate reactivity, particularly towards nucleophilic substitution reactions. It is stable under normal conditions but should be stored in a dry, cool place away from direct sunlight.

About

CAS No 234-80-0
English Name [1,2,4]triazolo[3,4-a]phthalazine
Molecular Formula C9H6N4
Molecular Weight 170.175 g/mol
SMILES C1=CC=C2C(=C1)C=NN3C2=NN=C3
InChIKey JVJPJKLSGUJUJK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) typically synthesized?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is synthesized via the condensation of 1,2,4-triaz...

Compound Q&A

What industries use [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is utilized in the pharmaceutical industry due to ...

Compound Q&A

What precautions should be taken when handling [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

When handling [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0), it is essential to use appropriate ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...