Compound Q&A

What industries use 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

Answer

2-Fluoro-pyridine-3-sulfonyl chloride
2-Fluoro-pyridine-3-sulfonyl chloride finds applications in pharmaceuticals, where it is used as an intermediate in the synthesis of certain drugs. It is also utilized in the production of organic semiconductors and in the development of sensors. Additionally, this compound is used in the preparation of various organic materials and as a reagent in organic synthesis.

About

English Name 2-Fluoro-pyridine-3-sulfonyl chloride
Molecular Formula C5H3ClFNO2S
Molecular Weight 195.60199999999998 g/mol
SMILES C1=CC(=C(N=C1)F)S(=O)(=O)Cl
InChIKey MSOAVTSXBMHOEM-UHFFFAOYSA-N
Last Updated: 2026-01-13 15:28

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

2-Fluoro-pyridine-3-sulfonyl chloride is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0) typically synthesized?

2-Fluoro-pyridine-3-sulfonyl chloride can be synthesized through the chlorosulfonation of 2-fluoro-p...

Compound Q&A

What precautions should be taken when handling 2-Fluoro-pyridine-3-sulfonyl chloride (CAS: 1089330-70-0)?

When handling 2-Fluoro-pyridine-3-sulfonyl chloride, it is important to use appropriate personal pro...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...