Compound Q&A

What precautions should be taken when handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

Answer

[2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
When handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5), appropriate personal protective equipment (PPE) such as gloves, safety goggles, and lab coats should be worn. This compound should be handled in a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the area should be well-ventilated. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name [2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
Molecular Formula C8H8BF3O3
Molecular Weight 219.96 g/mol
SMILES Cc1cc(OC(F)(F)F)ccc1B(O)O
InChIKey VZNGQLGNHIYWOD-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is a white crystalline solid wi...

Compound Q&A

How is (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) typically synthesized?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is commonly synthesized through...

Compound Q&A

What industries use (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is primarily used in the pharma...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...