Compound Q&A

What industries use (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

Answer

[2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is primarily used in the pharmaceutical and polymer industries for the preparation of medicinally active compounds and functional polymers. It is also utilized in semiconductor manufacturing for its stability and reactivity under various conditions.

About

English Name [2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
Molecular Formula C8H8BF3O3
Molecular Weight 219.96 g/mol
SMILES Cc1cc(OC(F)(F)F)ccc1B(O)O
InChIKey VZNGQLGNHIYWOD-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is a white crystalline solid wi...

Compound Q&A

How is (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) typically synthesized?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is commonly synthesized through...

Compound Q&A

What precautions should be taken when handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

When handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5), appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...