Compound Q&A

How is (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) typically synthesized?

Answer

[2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is commonly synthesized through a multistep process involving the protection of the phenolic hydroxyl group, followed by the introduction of the trifluoromethoxy group, and finally the generation of the boronic acid functionality. This synthesis typically requires catalysts like palladium(II) acetate and ligands such as Xantphos, with high selectivity and yields.

About

English Name [2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
Molecular Formula C8H8BF3O3
Molecular Weight 219.96 g/mol
SMILES Cc1cc(OC(F)(F)F)ccc1B(O)O
InChIKey VZNGQLGNHIYWOD-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is a white crystalline solid wi...

Compound Q&A

What industries use (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

When handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5), appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...