Compound Q&A

What are the physical and chemical properties of (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

Answer

[2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is a white crystalline solid with a molecular weight of approximately 320.11 g/mol. It has a low solubility in water but is soluble in organic solvents such as dichloromethane and acetonitrile. This compound is relatively stable but reactive towards strong bases and reducing agents. It is used in various synthetic applications due to its reactivity in Suzuki couplings.

About

English Name [2-Methyl-4-(trifluoromethoxy)phenyl]boronic acid
Molecular Formula C8H8BF3O3
Molecular Weight 219.96 g/mol
SMILES Cc1cc(OC(F)(F)F)ccc1B(O)O
InChIKey VZNGQLGNHIYWOD-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:11

Related Q&A

Compound Q&A

How is (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) typically synthesized?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is commonly synthesized through...

Compound Q&A

What industries use (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

(2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5) is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5)?

When handling (2-Methyl-4-(trifluoromethoxy)phenyl)boronic acid (CAS: 850033-39-5), appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...