Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

Answer

2,6-Dichloro-3-nitroaniline
When handling 2,6-Dichloro-3-nitroaniline, it is crucial to wear appropriate personal protective equipment (PPE), including safety goggles, gloves, and a lab coat. This compound should be used in a well-ventilated area or a fume hood due to its potential for fume generation. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly rinsed. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

CAS No 13785-48-3
English Name 2,6-Dichloro-3-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.02 g/mol
SMILES c1cc(c(c(c1N(=O)=O)Cl)N)Cl
InChIKey FYMVQJCDXFAPGG-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 222.02 g...

Compound Q&A

How is 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3) typically synthesized?

2,6-Dichloro-3-nitroaniline is synthesized through the nitration of 2,6-dichloroaniline using nitric...

Compound Q&A

What industries use 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...