Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

Answer

2,6-Dichloro-3-nitroaniline
2,6-Dichloro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 222.02 g/mol. It is sparingly soluble in water and highly soluble in organic solvents like ethanol. This compound is unstable under basic conditions and can undergo hydrolysis. Common reactions include nitration and chlorination.

About

CAS No 13785-48-3
English Name 2,6-Dichloro-3-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.02 g/mol
SMILES c1cc(c(c(c1N(=O)=O)Cl)N)Cl
InChIKey FYMVQJCDXFAPGG-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

How is 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3) typically synthesized?

2,6-Dichloro-3-nitroaniline is synthesized through the nitration of 2,6-dichloroaniline using nitric...

Compound Q&A

What industries use 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

When handling 2,6-Dichloro-3-nitroaniline, it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...