Compound Q&A

What industries use 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

Answer

2,6-Dichloro-3-nitroaniline
2,6-Dichloro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of various medicinal compounds. It also finds application in the production of dyes, pigments, and as a precursor for the synthesis of other chemical intermediates. Additionally, it can be used in analytical chemistry as a reagent.

About

CAS No 13785-48-3
English Name 2,6-Dichloro-3-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.02 g/mol
SMILES c1cc(c(c(c1N(=O)=O)Cl)N)Cl
InChIKey FYMVQJCDXFAPGG-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 222.02 g...

Compound Q&A

How is 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3) typically synthesized?

2,6-Dichloro-3-nitroaniline is synthesized through the nitration of 2,6-dichloroaniline using nitric...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

When handling 2,6-Dichloro-3-nitroaniline, it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...