Compound Q&A

How is 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3) typically synthesized?

Answer

2,6-Dichloro-3-nitroaniline
2,6-Dichloro-3-nitroaniline is synthesized through the nitration of 2,6-dichloroaniline using nitric acid and sulfuric acid as the nitrating agent. The reaction is conducted under controlled conditions to achieve high yield and selectivity. Catalysts like concentrated sulfuric acid are used to enhance the reaction rate and yield.

About

CAS No 13785-48-3
English Name 2,6-Dichloro-3-nitroaniline
Molecular Formula C6H4Cl2N2O2
Molecular Weight 207.02 g/mol
SMILES c1cc(c(c(c1N(=O)=O)Cl)N)Cl
InChIKey FYMVQJCDXFAPGG-UHFFFAOYSA-N
Last Updated: 2026-01-13 06:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is a crystalline solid with a molecular weight of approximately 222.02 g...

Compound Q&A

What industries use 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

2,6-Dichloro-3-nitroaniline is primarily used in the pharmaceutical industry for the synthesis of va...

Compound Q&A

What precautions should be taken when handling 2,6-Dichloro-3-nitroaniline (CAS: 13785-48-3)?

When handling 2,6-Dichloro-3-nitroaniline, it is crucial to wear appropriate personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...