Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

Answer

(2-Bromophenyl)methanesulfonyl chloride
When handling (2-Bromophenyl)methanesulfonyl chloride, appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat is necessary. The compound should be handled in a well-ventilated area or a fume hood due to its strong odor and potential reactivity. Spills should be cleaned up immediately with appropriate absorbents, and the area should be flushed with water. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 24974-74-1
English Name (2-Bromophenyl)methanesulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br
InChIKey RDRCWHIGMBAULL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is a solid at room temperature with a melting point of appro...

Compound Q&A

How is (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1) typically synthesized?

(2-Bromophenyl)methanesulfonyl chloride is usually synthesized by reacting 2-bromophenylmethane with...

Compound Q&A

What industries use (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...