Compound Q&A

What industries use (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

Answer

(2-Bromophenyl)methanesulfonyl chloride
(2-Bromophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for the synthesis of certain drugs, in polymer chemistry for the modification of polymers, and in sensor technology for the development of chemical sensors. Its reactivity makes it useful in various chemical transformations and derivatizations.

About

CAS No 24974-74-1
English Name (2-Bromophenyl)methanesulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br
InChIKey RDRCWHIGMBAULL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is a solid at room temperature with a melting point of appro...

Compound Q&A

How is (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1) typically synthesized?

(2-Bromophenyl)methanesulfonyl chloride is usually synthesized by reacting 2-bromophenylmethane with...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

When handling (2-Bromophenyl)methanesulfonyl chloride, appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...