Compound Q&A

How is (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1) typically synthesized?

Answer

(2-Bromophenyl)methanesulfonyl chloride
(2-Bromophenyl)methanesulfonyl chloride is usually synthesized by reacting 2-bromophenylmethane with methanesulfonyl chloride in the presence of a base like triethylamine. The reaction is typically carried out in dichloromethane under anhydrous conditions. The yield is high, and the product is isolated by acid work-up and recrystallization.

About

CAS No 24974-74-1
English Name (2-Bromophenyl)methanesulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br
InChIKey RDRCWHIGMBAULL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is a solid at room temperature with a melting point of appro...

Compound Q&A

What industries use (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

When handling (2-Bromophenyl)methanesulfonyl chloride, appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...