Compound Q&A

What are the physical and chemical properties of (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

Answer

(2-Bromophenyl)methanesulfonyl chloride
(2-Bromophenyl)methanesulfonyl chloride is a solid at room temperature with a melting point of approximately 94-97°C. Its molecular weight is about 287.04 g/mol. The compound is poorly soluble in water but soluble in organic solvents like dichloromethane and ethanol. It is highly reactive, particularly towards nucleophiles, and can undergo sulfonation and bromination reactions.

About

CAS No 24974-74-1
English Name (2-Bromophenyl)methanesulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Br
InChIKey RDRCWHIGMBAULL-UHFFFAOYSA-N
Last Updated: 2026-01-07 10:17

Related Q&A

Compound Q&A

How is (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1) typically synthesized?

(2-Bromophenyl)methanesulfonyl chloride is usually synthesized by reacting 2-bromophenylmethane with...

Compound Q&A

What industries use (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

(2-Bromophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for the synthesis of ...

Compound Q&A

What precautions should be taken when handling (2-Bromophenyl)methanesulfonyl chloride (CAS: 24974-74-1)?

When handling (2-Bromophenyl)methanesulfonyl chloride, appropriate personal protective equipment (PP...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...