Compound Q&A

What precautions should be taken when handling (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Answer

(3-Cyanophenyl)methanesulfonyl chloride
Proper handling of (3-Cyanophenyl)methanesulfonyl chloride requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure to the volatile and potentially toxic fumes. Spills should be carefully cleaned up following standard laboratory procedures, and the material safety data sheet (MSDS) should be consulted for detailed information on safe handling and disposal.

About

CAS No 56106-01-5
English Name (3-Cyanophenyl)methanesulfonyl chloride
Molecular Formula C8H6ClNO2S
Molecular Weight 215.66 g/mol
SMILES C1=CC(=CC(=C1)C#N)CS(=O)(=O)Cl
InChIKey YNWYDZBBHOWDAE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is a white to off-white crystalline solid with a molecular w...

Compound Q&A

How is (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5) typically synthesized?

(3-Cyanophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 3-cyanophenylmetha...

Compound Q&A

What industries use (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is used in various industries, particularly in pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...