Compound Q&A

What industries use (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Answer

(3-Cyanophenyl)methanesulfonyl chloride
(3-Cyanophenyl)methanesulfonyl chloride is used in various industries, particularly in pharmaceuticals and organic synthesis. It serves as a key intermediate in the synthesis of various bioactive compounds and drugs. Additionally, it is used in the preparation of certain polymers and in the development of sensors and semiconductors due to its reactivity and functional groups.

About

CAS No 56106-01-5
English Name (3-Cyanophenyl)methanesulfonyl chloride
Molecular Formula C8H6ClNO2S
Molecular Weight 215.66 g/mol
SMILES C1=CC(=CC(=C1)C#N)CS(=O)(=O)Cl
InChIKey YNWYDZBBHOWDAE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is a white to off-white crystalline solid with a molecular w...

Compound Q&A

How is (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5) typically synthesized?

(3-Cyanophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 3-cyanophenylmetha...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Proper handling of (3-Cyanophenyl)methanesulfonyl chloride requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...