Compound Q&A

How is (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5) typically synthesized?

Answer

(3-Cyanophenyl)methanesulfonyl chloride
(3-Cyanophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 3-cyanophenylmethanesulfonic acid with thionyl chloride. The reaction is typically carried out under anhydrous conditions and requires the use of a drying agent to minimize the presence of water, which can inhibit the reaction. The yield is generally high, and the product is isolated by recrystallization.

About

CAS No 56106-01-5
English Name (3-Cyanophenyl)methanesulfonyl chloride
Molecular Formula C8H6ClNO2S
Molecular Weight 215.66 g/mol
SMILES C1=CC(=CC(=C1)C#N)CS(=O)(=O)Cl
InChIKey YNWYDZBBHOWDAE-UHFFFAOYSA-N
Last Updated: 2026-01-02 00:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is a white to off-white crystalline solid with a molecular w...

Compound Q&A

What industries use (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

(3-Cyanophenyl)methanesulfonyl chloride is used in various industries, particularly in pharmaceutica...

Compound Q&A

What precautions should be taken when handling (3-Cyanophenyl)methanesulfonyl chloride (CAS: 56106-01-5)?

Proper handling of (3-Cyanophenyl)methanesulfonyl chloride requires the use of personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...